C16H15NO2 — CID 171901902
4-(1,2-dihydroacenaphthylen-5-yl)-3,4-dihydroxybutanenitrile (PubChem CID 171901902) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(1,2-dihydroacenaphthylen-5-yl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(1,2-dihydroacenaphthylen-5-yl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901902 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-(1,2-dihydroacenaphthylen-5-yl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C16H15NO2/c17-9-8-14(18)16(19)13-7-6-11-5-4-10-2-1-3-12(13)15(10)11/h1-3,6-7,14,16,18-19H,4-5,8H2 |
| InChIKey | QVOUTSSZJDOPDU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |