C12H12N2O2 — CID 171901139
3,4-dihydroxy-4-(1H-indol-4-yl)butanenitrile (PubChem CID 171901139) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(1H-indol-4-yl)butanenitrile.
| Compound Name | 3,4-dihydroxy-4-(1H-indol-4-yl)butanenitrile |
|---|---|
| PubChem CID | 171901139 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3,4-dihydroxy-4-(1H-indol-4-yl)butanenitrile |
| SMILES | N#CCC(O)C(O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C12H12N2O2/c13-6-4-11(15)12(16)9-2-1-3-10-8(9)5-7-14-10/h1-3,5,7,11-12,14-16H,4H2 |
| InChIKey | VVWHPTADKNMSDD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |