C10H11NO3 — CID 171900402
3,4-dihydroxy-4-(2-hydroxyphenyl)butanenitrile (PubChem CID 171900402) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(2-hydroxyphenyl)butanenitrile.
| Compound Name | 3,4-dihydroxy-4-(2-hydroxyphenyl)butanenitrile |
|---|---|
| PubChem CID | 171900402 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3,4-dihydroxy-4-(2-hydroxyphenyl)butanenitrile |
| SMILES | N#CCC(O)C(O)c1ccccc1O |
| InChI | InChI=1S/C10H11NO3/c11-6-5-9(13)10(14)7-3-1-2-4-8(7)12/h1-4,9-10,12-14H,5H2 |
| InChIKey | QWMUYLUSUJEFNI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |