C11H10N2O2S — CID 171900977
3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanenitrile (PubChem CID 171900977) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanenitrile.
| Compound Name | 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanenitrile |
|---|---|
| PubChem CID | 171900977 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanenitrile |
| SMILES | N#CCC(O)C(O)c1ccccc1N=C=S |
| InChI | InChI=1S/C11H10N2O2S/c12-6-5-10(14)11(15)8-3-1-2-4-9(8)13-7-16/h1-4,10-11,14-15H,5H2 |
| InChIKey | DGSMLOPZNUGLMV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|