C12H13NO4S — CID 171895601
methyl 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanoate (PubChem CID 171895601) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanoate |
|---|---|
| PubChem CID | 171895601 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccccc1N=C=S |
| InChI | InChI=1S/C12H13NO4S/c1-17-11(15)6-10(14)12(16)8-4-2-3-5-9(8)13-7-18/h2-5,10,12,14,16H,6H2,1H3 |
| InChIKey | UURRLDMJBGMQBM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|