methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate

C13H17NO6 — CID 171896268

IUPACmethyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate
SMILESCOC(=O)CC(O)C(O)c1cccc(C(=O)OC)c1N
InChIInChI=1S/C13H17NO6/c1-19-10(16)6-9(15)12(17)7-4-3-5-8(11(7)14)13(18)20-2/h3-5,9,12,15,17H,6,14H2,1-2H3
InChIKeyMJQHIWVWIXWJLM-UHFFFAOYSA-N
MW283.28 g/mol
LogP0.01
Rot. Bonds5

About methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate

methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate (PubChem CID 171896268) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate.

Molecular Properties

Compound Namemethyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate
PubChem CID171896268
Molecular FormulaC13H17NO6
Molecular Weight283.28 g/mol
Exact Mass283.11
IUPAC Namemethyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate
SMILESCOC(=O)CC(O)C(O)c1cccc(C(=O)OC)c1N
InChIInChI=1S/C13H17NO6/c1-19-10(16)6-9(15)12(17)7-4-3-5-8(11(7)14)13(18)20-2/h3-5,9,12,15,17H,6,14H2,1-2H3
InChIKeyMJQHIWVWIXWJLM-UHFFFAOYSA-N
XLogP0.01
TPSA119.08 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.28
LogP ≤ 50.01
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate?
The IUPAC name of methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate (CID 171896268) is methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate.
What is the SMILES notation for methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate?
The canonical SMILES for methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate is COC(=O)CC(O)C(O)c1cccc(C(=O)OC)c1N.
What is the InChIKey of methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate?
The InChIKey is MJQHIWVWIXWJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO6/c1-19-10(16)6-9(15)12(17)7-4-3-5-8(11(7)14)13(18)20-2/h3-5,9,12,15,17H,6,14H2,1-2H3.
What are the key properties of methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate?
methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate has a molecular weight of 283.28 g/mol, XLogP of 0.01, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate is sourced from PubChem (CID 171896268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).