C13H17NO6 — CID 171896268
methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate (PubChem CID 171896268) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate.
| Compound Name | methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate |
|---|---|
| PubChem CID | 171896268 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | methyl 2-amino-3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)benzoate |
| SMILES | COC(=O)CC(O)C(O)c1cccc(C(=O)OC)c1N |
| InChI | InChI=1S/C13H17NO6/c1-19-10(16)6-9(15)12(17)7-4-3-5-8(11(7)14)13(18)20-2/h3-5,9,12,15,17H,6,14H2,1-2H3 |
| InChIKey | MJQHIWVWIXWJLM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|