C13H12O7 — CID 171896338
methyl 4-(1,3-dioxo-2-benzofuran-4-yl)-3,4-dihydroxybutanoate (PubChem CID 171896338) has the molecular formula C13H12O7 and a molecular weight of 280.23 g/mol. Its IUPAC name is methyl 4-(1,3-dioxo-2-benzofuran-4-yl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(1,3-dioxo-2-benzofuran-4-yl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896338 |
| Molecular Formula | C13H12O7 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | methyl 4-(1,3-dioxo-2-benzofuran-4-yl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1cccc2c1C(=O)OC2=O |
| InChI | InChI=1S/C13H12O7/c1-19-9(15)5-8(14)11(16)6-3-2-4-7-10(6)13(18)20-12(7)17/h2-4,8,11,14,16H,5H2,1H3 |
| InChIKey | VZHWPHQNQFZKHP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|