C13H15NO5 — CID 171890965
4-[1,2-dihydroxy-4-(methylamino)butyl]-2-benzofuran-1,3-dione (PubChem CID 171890965) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 4-[1,2-dihydroxy-4-(methylamino)butyl]-2-benzofuran-1,3-dione.
| Compound Name | 4-[1,2-dihydroxy-4-(methylamino)butyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 171890965 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-[1,2-dihydroxy-4-(methylamino)butyl]-2-benzofuran-1,3-dione |
| SMILES | CNCCC(O)C(O)c1cccc2c1C(=O)OC2=O |
| InChI | InChI=1S/C13H15NO5/c1-14-6-5-9(15)11(16)7-3-2-4-8-10(7)13(18)19-12(8)17/h2-4,9,11,14-16H,5-6H2,1H3 |
| InChIKey | AMLQPSQSLAOFMR-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|