C13H21NO3 — CID 171890149
1-(2-ethoxyphenyl)-4-(methylamino)butane-1,2-diol (PubChem CID 171890149) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(2-ethoxyphenyl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171890149 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-(2-ethoxyphenyl)-4-(methylamino)butane-1,2-diol |
| SMILES | CCOc1ccccc1C(O)C(O)CCNC |
| InChI | InChI=1S/C13H21NO3/c1-3-17-12-7-5-4-6-10(12)13(16)11(15)8-9-14-2/h4-7,11,13-16H,3,8-9H2,1-2H3 |
| InChIKey | NVZMPIWEBZPQLT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |