C12H19NO2S — CID 171889747
4-(methylamino)-1-(2-methylsulfanylphenyl)butane-1,2-diol (PubChem CID 171889747) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 4-(methylamino)-1-(2-methylsulfanylphenyl)butane-1,2-diol.
| Compound Name | 4-(methylamino)-1-(2-methylsulfanylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171889747 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-(methylamino)-1-(2-methylsulfanylphenyl)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1ccccc1SC |
| InChI | InChI=1S/C12H19NO2S/c1-13-8-7-10(14)12(15)9-5-3-4-6-11(9)16-2/h3-6,10,12-15H,7-8H2,1-2H3 |
| InChIKey | MQLXQHILYCZSKR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |