C11H19N3O2 — CID 171889879
1-(2-hydrazinylphenyl)-4-(methylamino)butane-1,2-diol (PubChem CID 171889879) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-(2-hydrazinylphenyl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(2-hydrazinylphenyl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171889879 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-(2-hydrazinylphenyl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1ccccc1NN |
| InChI | InChI=1S/C11H19N3O2/c1-13-7-6-10(15)11(16)8-4-2-3-5-9(8)14-12/h2-5,10-11,13-16H,6-7,12H2,1H3 |
| InChIKey | SZVPGGDCBZQNCU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|