C12H11ClO5 — CID 171894548
4-(4-chloro-1,2-dihydroxybutyl)-2-benzofuran-1,3-dione (PubChem CID 171894548) has the molecular formula C12H11ClO5 and a molecular weight of 270.67 g/mol. Its IUPAC name is 4-(4-chloro-1,2-dihydroxybutyl)-2-benzofuran-1,3-dione.
| Compound Name | 4-(4-chloro-1,2-dihydroxybutyl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 171894548 |
| Molecular Formula | C12H11ClO5 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 4-(4-chloro-1,2-dihydroxybutyl)-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c1cccc2C(O)C(O)CCCl |
| InChI | InChI=1S/C12H11ClO5/c13-5-4-8(14)10(15)6-2-1-3-7-9(6)12(17)18-11(7)16/h1-3,8,10,14-15H,4-5H2 |
| InChIKey | BAXCQKAPXHXYOF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|