C14H14Cl2O2 — CID 171894527
4-chloro-1-(8-chloronaphthalen-1-yl)butane-1,2-diol (PubChem CID 171894527) has the molecular formula C14H14Cl2O2 and a molecular weight of 285.17 g/mol. Its IUPAC name is 4-chloro-1-(8-chloronaphthalen-1-yl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(8-chloronaphthalen-1-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171894527 |
| Molecular Formula | C14H14Cl2O2 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-chloro-1-(8-chloronaphthalen-1-yl)butane-1,2-diol |
| SMILES | OC(CCCl)C(O)c1cccc2cccc(Cl)c12 |
| InChI | InChI=1S/C14H14Cl2O2/c15-8-7-12(17)14(18)10-5-1-3-9-4-2-6-11(16)13(9)10/h1-6,12,14,17-18H,7-8H2 |
| InChIKey | JVQJBGMVNCXKSR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|