C11H14ClNO3 — CID 171894927
2-(4-chloro-1,2-dihydroxybutyl)benzamide (PubChem CID 171894927) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-(4-chloro-1,2-dihydroxybutyl)benzamide.
| Compound Name | 2-(4-chloro-1,2-dihydroxybutyl)benzamide |
|---|---|
| PubChem CID | 171894927 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-(4-chloro-1,2-dihydroxybutyl)benzamide |
| SMILES | NC(=O)c1ccccc1C(O)C(O)CCCl |
| InChI | InChI=1S/C11H14ClNO3/c12-6-5-9(14)10(15)7-3-1-2-4-8(7)11(13)16/h1-4,9-10,14-15H,5-6H2,(H2,13,16) |
| InChIKey | JQMPDVRVWBMYEO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|