C12H16ClNO4 — CID 171894472
2-(4-chloro-1,2-dihydroxybutyl)-5-methoxybenzamide (PubChem CID 171894472) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is 2-(4-chloro-1,2-dihydroxybutyl)-5-methoxybenzamide.
| Compound Name | 2-(4-chloro-1,2-dihydroxybutyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 171894472 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(4-chloro-1,2-dihydroxybutyl)-5-methoxybenzamide |
| SMILES | COc1ccc(C(O)C(O)CCCl)c(C(N)=O)c1 |
| InChI | InChI=1S/C12H16ClNO4/c1-18-7-2-3-8(9(6-7)12(14)17)11(16)10(15)4-5-13/h2-3,6,10-11,15-16H,4-5H2,1H3,(H2,14,17) |
| InChIKey | FIIZXYVEGARVLQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|