C11H16ClNO4 — CID 171894271
4-chloro-1-(2,6-dimethoxy-3-pyridinyl)butane-1,2-diol (PubChem CID 171894271) has the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. Its IUPAC name is 4-chloro-1-(2,6-dimethoxy-3-pyridinyl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(2,6-dimethoxy-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171894271 |
| Molecular Formula | C11H16ClNO4 |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-chloro-1-(2,6-dimethoxy-3-pyridinyl)butane-1,2-diol |
| SMILES | COc1ccc(C(O)C(O)CCCl)c(OC)n1 |
| InChI | InChI=1S/C11H16ClNO4/c1-16-9-4-3-7(11(13-9)17-2)10(15)8(14)5-6-12/h3-4,8,10,14-15H,5-6H2,1-2H3 |
| InChIKey | VYRHMCUDFIYABI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|