C11H17NO5 — CID 171872771
1-(2,6-dimethoxy-3-pyridinyl)butane-1,2,4-triol (PubChem CID 171872771) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is 1-(2,6-dimethoxy-3-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(2,6-dimethoxy-3-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872771 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 1-(2,6-dimethoxy-3-pyridinyl)butane-1,2,4-triol |
| SMILES | COc1ccc(C(O)C(O)CCO)c(OC)n1 |
| InChI | InChI=1S/C11H17NO5/c1-16-9-4-3-7(11(12-9)17-2)10(15)8(14)5-6-13/h3-4,8,10,13-15H,5-6H2,1-2H3 |
| InChIKey | ZPOYFRKLIDGUAP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |