C10H14BrNO3 — CID 171860100
3-bromo-1-(6-methoxy-2-methyl-3-pyridinyl)propane-1,2-diol (PubChem CID 171860100) has the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. Its IUPAC name is 3-bromo-1-(6-methoxy-2-methyl-3-pyridinyl)propane-1,2-diol.
| Compound Name | 3-bromo-1-(6-methoxy-2-methyl-3-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171860100 |
| Molecular Formula | C10H14BrNO3 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 3-bromo-1-(6-methoxy-2-methyl-3-pyridinyl)propane-1,2-diol |
| SMILES | COc1ccc(C(O)C(O)CBr)c(C)n1 |
| InChI | InChI=1S/C10H14BrNO3/c1-6-7(10(14)8(13)5-11)3-4-9(12-6)15-2/h3-4,8,10,13-14H,5H2,1-2H3 |
| InChIKey | GLSDJTFOQFTIHK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|