C9H13BrN2O3 — CID 171859985
1-(3-amino-6-methoxy-2-pyridinyl)-3-bromopropane-1,2-diol (PubChem CID 171859985) has the molecular formula C9H13BrN2O3 and a molecular weight of 277.12 g/mol. Its IUPAC name is 1-(3-amino-6-methoxy-2-pyridinyl)-3-bromopropane-1,2-diol.
| Compound Name | 1-(3-amino-6-methoxy-2-pyridinyl)-3-bromopropane-1,2-diol |
|---|---|
| PubChem CID | 171859985 |
| Molecular Formula | C9H13BrN2O3 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 1-(3-amino-6-methoxy-2-pyridinyl)-3-bromopropane-1,2-diol |
| SMILES | COc1ccc(N)c(C(O)C(O)CBr)n1 |
| InChI | InChI=1S/C9H13BrN2O3/c1-15-7-3-2-5(11)8(12-7)9(14)6(13)4-10/h2-3,6,9,13-14H,4,11H2,1H3 |
| InChIKey | GFZICHFSZKRKGJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|