C11H16BrNO2 — CID 171860042
1-(4-amino-2,3-dimethylphenyl)-3-bromopropane-1,2-diol (PubChem CID 171860042) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is 1-(4-amino-2,3-dimethylphenyl)-3-bromopropane-1,2-diol.
| Compound Name | 1-(4-amino-2,3-dimethylphenyl)-3-bromopropane-1,2-diol |
|---|---|
| PubChem CID | 171860042 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 1-(4-amino-2,3-dimethylphenyl)-3-bromopropane-1,2-diol |
| SMILES | Cc1c(N)ccc(C(O)C(O)CBr)c1C |
| InChI | InChI=1S/C11H16BrNO2/c1-6-7(2)9(13)4-3-8(6)11(15)10(14)5-12/h3-4,10-11,14-15H,5,13H2,1-2H3 |
| InChIKey | MNUCIHXPILJDGI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|