C10H13ClFNO2 — CID 171862059
1-(4-amino-2-fluoro-3-methylphenyl)-3-chloropropane-1,2-diol (PubChem CID 171862059) has the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. Its IUPAC name is 1-(4-amino-2-fluoro-3-methylphenyl)-3-chloropropane-1,2-diol.
| Compound Name | 1-(4-amino-2-fluoro-3-methylphenyl)-3-chloropropane-1,2-diol |
|---|---|
| PubChem CID | 171862059 |
| Molecular Formula | C10H13ClFNO2 |
| Molecular Weight | 233.67 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-(4-amino-2-fluoro-3-methylphenyl)-3-chloropropane-1,2-diol |
| SMILES | Cc1c(N)ccc(C(O)C(O)CCl)c1F |
| InChI | InChI=1S/C10H13ClFNO2/c1-5-7(13)3-2-6(9(5)12)10(15)8(14)4-11/h2-3,8,10,14-15H,4,13H2,1H3 |
| InChIKey | YNSDHADBUFPYTQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.67 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|