C12H17FN2O3 — CID 170830083
N-[3-(4-amino-2-fluoro-3-methylphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830083) has the molecular formula C12H17FN2O3 and a molecular weight of 256.28 g/mol. Its IUPAC name is N-[3-(4-amino-2-fluoro-3-methylphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(4-amino-2-fluoro-3-methylphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830083 |
| Molecular Formula | C12H17FN2O3 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-[3-(4-amino-2-fluoro-3-methylphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1ccc(N)c(C)c1F |
| InChI | InChI=1S/C12H17FN2O3/c1-6-9(14)4-3-8(11(6)13)12(18)10(17)5-15-7(2)16/h3-4,10,12,17-18H,5,14H2,1-2H3,(H,15,16) |
| InChIKey | ANLOAJYUUYKQJM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|