methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate

C13H16FNO5 — CID 170830610

IUPACmethyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate
SMILESCOC(=O)c1cccc(C(O)C(O)CNC(C)=O)c1F
InChIInChI=1S/C13H16FNO5/c1-7(16)15-6-10(17)12(18)8-4-3-5-9(11(8)14)13(19)20-2/h3-5,10,12,17-18H,6H2,1-2H3,(H,15,16)
InChIKeyQTLLVSFOCHZJFJ-UHFFFAOYSA-N
MW285.27 g/mol
LogP0.14
Rot. Bonds5

About methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate

methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate (PubChem CID 170830610) has the molecular formula C13H16FNO5 and a molecular weight of 285.27 g/mol. Its IUPAC name is methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate.

Molecular Properties

Compound Namemethyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate
PubChem CID170830610
Molecular FormulaC13H16FNO5
Molecular Weight285.27 g/mol
Exact Mass285.10
IUPAC Namemethyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate
SMILESCOC(=O)c1cccc(C(O)C(O)CNC(C)=O)c1F
InChIInChI=1S/C13H16FNO5/c1-7(16)15-6-10(17)12(18)8-4-3-5-9(11(8)14)13(19)20-2/h3-5,10,12,17-18H,6H2,1-2H3,(H,15,16)
InChIKeyQTLLVSFOCHZJFJ-UHFFFAOYSA-N
XLogP0.14
TPSA95.86 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.27
LogP ≤ 50.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate?
The IUPAC name of methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate (CID 170830610) is methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate.
What is the SMILES notation for methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate?
The canonical SMILES for methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate is COC(=O)c1cccc(C(O)C(O)CNC(C)=O)c1F.
What is the InChIKey of methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate?
The InChIKey is QTLLVSFOCHZJFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO5/c1-7(16)15-6-10(17)12(18)8-4-3-5-9(11(8)14)13(19)20-2/h3-5,10,12,17-18H,6H2,1-2H3,(H,15,16).
What are the key properties of methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate?
methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate has a molecular weight of 285.27 g/mol, XLogP of 0.14, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate is sourced from PubChem (CID 170830610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).