C13H16FNO5 — CID 170830610
methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate (PubChem CID 170830610) has the molecular formula C13H16FNO5 and a molecular weight of 285.27 g/mol. Its IUPAC name is methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate.
| Compound Name | methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 170830610 |
| Molecular Formula | C13H16FNO5 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methyl 3-(3-acetamido-1,2-dihydroxypropyl)-2-fluorobenzoate |
| SMILES | COC(=O)c1cccc(C(O)C(O)CNC(C)=O)c1F |
| InChI | InChI=1S/C13H16FNO5/c1-7(16)15-6-10(17)12(18)8-4-3-5-9(11(8)14)13(19)20-2/h3-5,10,12,17-18H,6H2,1-2H3,(H,15,16) |
| InChIKey | QTLLVSFOCHZJFJ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |