C12H16FNO4 — CID 170829935
N-[3-(2-fluoro-5-methoxyphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170829935) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is N-[3-(2-fluoro-5-methoxyphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(2-fluoro-5-methoxyphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170829935 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-[3-(2-fluoro-5-methoxyphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | COc1ccc(F)c(C(O)C(O)CNC(C)=O)c1 |
| InChI | InChI=1S/C12H16FNO4/c1-7(15)14-6-11(16)12(17)9-5-8(18-2)3-4-10(9)13/h3-5,11-12,16-17H,6H2,1-2H3,(H,14,15) |
| InChIKey | HCQGSIAXTKGYMS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |