C12H15F2NO4 — CID 170830406
N-[3-(3,5-difluoro-2-methoxyphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830406) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is N-[3-(3,5-difluoro-2-methoxyphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(3,5-difluoro-2-methoxyphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830406 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-[3-(3,5-difluoro-2-methoxyphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | COc1c(F)cc(F)cc1C(O)C(O)CNC(C)=O |
| InChI | InChI=1S/C12H15F2NO4/c1-6(16)15-5-10(17)11(18)8-3-7(13)4-9(14)12(8)19-2/h3-4,10-11,17-18H,5H2,1-2H3,(H,15,16) |
| InChIKey | PDQDYGJBEITLGE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |