C11H14F2O3S — CID 171874440
1-(3,5-difluoro-2-methoxyphenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171874440) has the molecular formula C11H14F2O3S and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-methoxyphenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(3,5-difluoro-2-methoxyphenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874440 |
| Molecular Formula | C11H14F2O3S |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1-(3,5-difluoro-2-methoxyphenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | COc1c(F)cc(F)cc1C(O)C(O)CCS |
| InChI | InChI=1S/C11H14F2O3S/c1-16-11-7(4-6(12)5-8(11)13)10(15)9(14)2-3-17/h4-5,9-10,14-15,17H,2-3H2,1H3 |
| InChIKey | YQRCLGFTOOFNBK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|