C10H11ClF2O3 — CID 171862381
3-chloro-1-(3,5-difluoro-2-methoxyphenyl)propane-1,2-diol (PubChem CID 171862381) has the molecular formula C10H11ClF2O3 and a molecular weight of 252.64 g/mol. Its IUPAC name is 3-chloro-1-(3,5-difluoro-2-methoxyphenyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(3,5-difluoro-2-methoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171862381 |
| Molecular Formula | C10H11ClF2O3 |
| Molecular Weight | 252.64 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 3-chloro-1-(3,5-difluoro-2-methoxyphenyl)propane-1,2-diol |
| SMILES | COc1c(F)cc(F)cc1C(O)C(O)CCl |
| InChI | InChI=1S/C10H11ClF2O3/c1-16-10-6(9(15)8(14)4-11)2-5(12)3-7(10)13/h2-3,8-9,14-15H,4H2,1H3 |
| InChIKey | DONURQSECHYOOP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.64 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|