C12H17ClO4 — CID 171862593
3-chloro-1-[2-(dimethoxymethyl)phenyl]propane-1,2-diol (PubChem CID 171862593) has the molecular formula C12H17ClO4 and a molecular weight of 260.72 g/mol. Its IUPAC name is 3-chloro-1-[2-(dimethoxymethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-chloro-1-[2-(dimethoxymethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 171862593 |
| Molecular Formula | C12H17ClO4 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-chloro-1-[2-(dimethoxymethyl)phenyl]propane-1,2-diol |
| SMILES | COC(OC)c1ccccc1C(O)C(O)CCl |
| InChI | InChI=1S/C12H17ClO4/c1-16-12(17-2)9-6-4-3-5-8(9)11(15)10(14)7-13/h3-6,10-12,14-15H,7H2,1-2H3 |
| InChIKey | ZMQQTQBYTGRPKH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|