C10H10ClNO2 — CID 171861777
2-(3-chloro-1,2-dihydroxypropyl)benzonitrile (PubChem CID 171861777) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 2-(3-chloro-1,2-dihydroxypropyl)benzonitrile.
| Compound Name | 2-(3-chloro-1,2-dihydroxypropyl)benzonitrile |
|---|---|
| PubChem CID | 171861777 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-(3-chloro-1,2-dihydroxypropyl)benzonitrile |
| SMILES | N#Cc1ccccc1C(O)C(O)CCl |
| InChI | InChI=1S/C10H10ClNO2/c11-5-9(13)10(14)8-4-2-1-3-7(8)6-12/h1-4,9-10,13-14H,5H2 |
| InChIKey | VGIQGBVNBUJMOV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|