C11H15ClN2O — CID 171261638
2-[(1R,2S)-1-amino-2-hydroxybutyl]benzonitrile;hydrochloride (PubChem CID 171261638) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxybutyl]benzonitrile;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxybutyl]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171261638 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxybutyl]benzonitrile;hydrochloride |
| SMILES | CC[C@H](O)[C@H](N)c1ccccc1C#N.Cl |
| InChI | InChI=1S/C11H14N2O.ClH/c1-2-10(14)11(13)9-6-4-3-5-8(9)7-12;/h3-6,10-11,14H,2,13H2,1H3;1H/t10-,11+;/m0./s1 |
| InChIKey | WKNNKNCSEULXQO-VZXYPILPSA-N |
| XLogP | 1.75 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |