C10H15ClFNO — CID 171160706
(1R,2S)-1-amino-1-(2-fluorophenyl)butan-2-ol;hydrochloride (PubChem CID 171160706) has the molecular formula C10H15ClFNO and a molecular weight of 219.69 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2-fluorophenyl)butan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(2-fluorophenyl)butan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171160706 |
| Molecular Formula | C10H15ClFNO |
| Molecular Weight | 219.69 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | (1R,2S)-1-amino-1-(2-fluorophenyl)butan-2-ol;hydrochloride |
| SMILES | CC[C@H](O)[C@H](N)c1ccccc1F.Cl |
| InChI | InChI=1S/C10H14FNO.ClH/c1-2-9(13)10(12)7-5-3-4-6-8(7)11;/h3-6,9-10,13H,2,12H2,1H3;1H/t9-,10+;/m0./s1 |
| InChIKey | PYBPGBCJIXSWKI-BAUSSPIASA-N |
| XLogP | 2.02 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.69 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |