C11H16FNO — CID 130683149
(1S,2R)-1-amino-1-(2-fluoro-4-methylphenyl)butan-2-ol (PubChem CID 130683149) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2-fluoro-4-methylphenyl)butan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2-fluoro-4-methylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 130683149 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (1S,2R)-1-amino-1-(2-fluoro-4-methylphenyl)butan-2-ol |
| SMILES | CC[C@@H](O)[C@@H](N)c1ccc(C)cc1F |
| InChI | InChI=1S/C11H16FNO/c1-3-10(14)11(13)8-5-4-7(2)6-9(8)12/h4-6,10-11,14H,3,13H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | FIAKIUPRGKBUPQ-MNOVXSKESA-N |
| XLogP | 1.90 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |