C10H13BrFNO — CID 130785366
(1R,2S)-1-amino-1-(3-bromo-2-fluorophenyl)butan-2-ol (PubChem CID 130785366) has the molecular formula C10H13BrFNO and a molecular weight of 262.12 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(3-bromo-2-fluorophenyl)butan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(3-bromo-2-fluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 130785366 |
| Molecular Formula | C10H13BrFNO |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | (1R,2S)-1-amino-1-(3-bromo-2-fluorophenyl)butan-2-ol |
| SMILES | CC[C@H](O)[C@H](N)c1cccc(Br)c1F |
| InChI | InChI=1S/C10H13BrFNO/c1-2-8(14)10(13)6-4-3-5-7(11)9(6)12/h3-5,8,10,14H,2,13H2,1H3/t8-,10+/m0/s1 |
| InChIKey | NBQBCEMJPCBYPH-WCBMZHEXSA-N |
| XLogP | 2.36 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |