C10H13BrFN — CID 103692974
1-(3-bromo-2-fluorophenyl)butan-1-amine (PubChem CID 103692974) has the molecular formula C10H13BrFN and a molecular weight of 246.12 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)butan-1-amine.
| Compound Name | 1-(3-bromo-2-fluorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 103692974 |
| Molecular Formula | C10H13BrFN |
| Molecular Weight | 246.12 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)butan-1-amine |
| SMILES | CCCC(N)c1cccc(Br)c1F |
| InChI | InChI=1S/C10H13BrFN/c1-2-4-9(13)7-5-3-6-8(11)10(7)12/h3,5-6,9H,2,4,13H2,1H3 |
| InChIKey | KKIVKHVMIKWNTK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.12 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |