C10H14BrFN2 — CID 106648656
1-(3-bromo-2-fluorophenyl)butylhydrazine (PubChem CID 106648656) has the molecular formula C10H14BrFN2 and a molecular weight of 261.14 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)butylhydrazine.
| Compound Name | 1-(3-bromo-2-fluorophenyl)butylhydrazine |
|---|---|
| PubChem CID | 106648656 |
| Molecular Formula | C10H14BrFN2 |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)butylhydrazine |
| SMILES | CCCC(NN)c1cccc(Br)c1F |
| InChI | InChI=1S/C10H14BrFN2/c1-2-4-9(14-13)7-5-3-6-8(11)10(7)12/h3,5-6,9,14H,2,4,13H2,1H3 |
| InChIKey | BMJIMSMVXDUESK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|