C10H13BrClFN2 — CID 106649111
[1-(3-bromo-2-fluorophenyl)-4-chlorobutyl]hydrazine (PubChem CID 106649111) has the molecular formula C10H13BrClFN2 and a molecular weight of 295.58 g/mol. Its IUPAC name is [1-(3-bromo-2-fluorophenyl)-4-chlorobutyl]hydrazine.
| Compound Name | [1-(3-bromo-2-fluorophenyl)-4-chlorobutyl]hydrazine |
|---|---|
| PubChem CID | 106649111 |
| Molecular Formula | C10H13BrClFN2 |
| Molecular Weight | 295.58 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | [1-(3-bromo-2-fluorophenyl)-4-chlorobutyl]hydrazine |
| SMILES | NNC(CCCCl)c1cccc(Br)c1F |
| InChI | InChI=1S/C10H13BrClFN2/c11-8-4-1-3-7(10(8)13)9(15-14)5-2-6-12/h1,3-4,9,15H,2,5-6,14H2 |
| InChIKey | WGPTWRAXUDNGNX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|