C11H13BrF4N2O — CID 106649704
[1-(3-bromo-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine (PubChem CID 106649704) has the molecular formula C11H13BrF4N2O and a molecular weight of 345.13 g/mol. Its IUPAC name is [1-(3-bromo-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine.
| Compound Name | [1-(3-bromo-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 106649704 |
| Molecular Formula | C11H13BrF4N2O |
| Molecular Weight | 345.13 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | [1-(3-bromo-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)(F)F)c1cccc(Br)c1F |
| InChI | InChI=1S/C11H13BrF4N2O/c12-8-3-1-2-7(10(8)13)9(18-17)4-5-19-6-11(14,15)16/h1-3,9,18H,4-6,17H2 |
| InChIKey | OZCUQRKRMNZBCE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.13 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|