C15H21F3N2O — CID 103151448
[1-(2-cyclobutylphenyl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine (PubChem CID 103151448) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is [1-(2-cyclobutylphenyl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine.
| Compound Name | [1-(2-cyclobutylphenyl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103151448 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [1-(2-cyclobutylphenyl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)(F)F)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C15H21F3N2O/c16-15(17,18)10-21-9-8-14(20-19)13-7-2-1-6-12(13)11-4-3-5-11/h1-2,6-7,11,14,20H,3-5,8-10,19H2 |
| InChIKey | BDJLVCABOGSEPC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|