C12H14F6N2O — CID 103151641
[3-(2,2,2-trifluoroethoxy)-1-[4-(trifluoromethyl)phenyl]propyl]hydrazine (PubChem CID 103151641) has the molecular formula C12H14F6N2O and a molecular weight of 316.25 g/mol. Its IUPAC name is [3-(2,2,2-trifluoroethoxy)-1-[4-(trifluoromethyl)phenyl]propyl]hydrazine.
| Compound Name | [3-(2,2,2-trifluoroethoxy)-1-[4-(trifluoromethyl)phenyl]propyl]hydrazine |
|---|---|
| PubChem CID | 103151641 |
| Molecular Formula | C12H14F6N2O |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | [3-(2,2,2-trifluoroethoxy)-1-[4-(trifluoromethyl)phenyl]propyl]hydrazine |
| SMILES | NNC(CCOCC(F)(F)F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F6N2O/c13-11(14,15)7-21-6-5-10(20-19)8-1-3-9(4-2-8)12(16,17)18/h1-4,10,20H,5-7,19H2 |
| InChIKey | AVGUMXYLIXJSJR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|