C9H12BrF3N2OS — CID 103151632
[1-(3-bromothiophen-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine (PubChem CID 103151632) has the molecular formula C9H12BrF3N2OS and a molecular weight of 333.17 g/mol. Its IUPAC name is [1-(3-bromothiophen-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine.
| Compound Name | [1-(3-bromothiophen-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103151632 |
| Molecular Formula | C9H12BrF3N2OS |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | [1-(3-bromothiophen-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)(F)F)c1sccc1Br |
| InChI | InChI=1S/C9H12BrF3N2OS/c10-6-2-4-17-8(6)7(15-14)1-3-16-5-9(11,12)13/h2,4,7,15H,1,3,5,14H2 |
| InChIKey | KOMAEPROBPSTGR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|