C9H15BrN2OS — CID 105210144
[1-(3-bromothiophen-2-yl)-2-propoxyethyl]hydrazine (PubChem CID 105210144) has the molecular formula C9H15BrN2OS and a molecular weight of 279.20 g/mol. Its IUPAC name is [1-(3-bromothiophen-2-yl)-2-propoxyethyl]hydrazine.
| Compound Name | [1-(3-bromothiophen-2-yl)-2-propoxyethyl]hydrazine |
|---|---|
| PubChem CID | 105210144 |
| Molecular Formula | C9H15BrN2OS |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | [1-(3-bromothiophen-2-yl)-2-propoxyethyl]hydrazine |
| SMILES | CCCOCC(NN)c1sccc1Br |
| InChI | InChI=1S/C9H15BrN2OS/c1-2-4-13-6-8(12-11)9-7(10)3-5-14-9/h3,5,8,12H,2,4,6,11H2,1H3 |
| InChIKey | XXAWZWARNAJCCK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|