C14H16F3N3O — CID 103151703
[1-quinolin-7-yl-3-(2,2,2-trifluoroethoxy)propyl]hydrazine (PubChem CID 103151703) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is [1-quinolin-7-yl-3-(2,2,2-trifluoroethoxy)propyl]hydrazine.
| Compound Name | [1-quinolin-7-yl-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103151703 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [1-quinolin-7-yl-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)(F)F)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C14H16F3N3O/c15-14(16,17)9-21-7-5-12(20-18)11-4-3-10-2-1-6-19-13(10)8-11/h1-4,6,8,12,20H,5,7,9,18H2 |
| InChIKey | WXGGFOABKWDITF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|