C14H21BrFNO2 — CID 106646214
1-(3-bromo-2-fluorophenyl)-N-ethyl-3-(2-methoxyethoxy)propan-1-amine (PubChem CID 106646214) has the molecular formula C14H21BrFNO2 and a molecular weight of 334.23 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)-N-ethyl-3-(2-methoxyethoxy)propan-1-amine.
| Compound Name | 1-(3-bromo-2-fluorophenyl)-N-ethyl-3-(2-methoxyethoxy)propan-1-amine |
|---|---|
| PubChem CID | 106646214 |
| Molecular Formula | C14H21BrFNO2 |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)-N-ethyl-3-(2-methoxyethoxy)propan-1-amine |
| SMILES | CCNC(CCOCCOC)c1cccc(Br)c1F |
| InChI | InChI=1S/C14H21BrFNO2/c1-3-17-13(7-8-19-10-9-18-2)11-5-4-6-12(15)14(11)16/h4-6,13,17H,3,7-10H2,1-2H3 |
| InChIKey | NTFRKJNZVUMPJY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|