C14H21BrFNS — CID 106645644
1-(3-bromo-2-fluorophenyl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine (PubChem CID 106645644) has the molecular formula C14H21BrFNS and a molecular weight of 334.30 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine.
| Compound Name | 1-(3-bromo-2-fluorophenyl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 106645644 |
| Molecular Formula | C14H21BrFNS |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine |
| SMILES | CCNC(CSCC(C)C)c1cccc(Br)c1F |
| InChI | InChI=1S/C14H21BrFNS/c1-4-17-13(9-18-8-10(2)3)11-6-5-7-12(15)14(11)16/h5-7,10,13,17H,4,8-9H2,1-3H3 |
| InChIKey | ZSBKWDXBGHYCAR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |