C14H20BrF2NS — CID 106942556
1-(3-bromo-2,6-difluorophenyl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine (PubChem CID 106942556) has the molecular formula C14H20BrF2NS and a molecular weight of 352.29 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 106942556 |
| Molecular Formula | C14H20BrF2NS |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-N-ethyl-2-(2-methylpropylsulfanyl)ethanamine |
| SMILES | CCNC(CSCC(C)C)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H20BrF2NS/c1-4-18-12(8-19-7-9(2)3)13-11(16)6-5-10(15)14(13)17/h5-6,9,12,18H,4,7-8H2,1-3H3 |
| InChIKey | KZPANZPKBFGOOT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|