C15H22BrF2NS — CID 106942561
N-[1-(3-bromo-2,6-difluorophenyl)-2-butan-2-ylsulfanylethyl]propan-1-amine (PubChem CID 106942561) has the molecular formula C15H22BrF2NS and a molecular weight of 366.32 g/mol. Its IUPAC name is N-[1-(3-bromo-2,6-difluorophenyl)-2-butan-2-ylsulfanylethyl]propan-1-amine.
| Compound Name | N-[1-(3-bromo-2,6-difluorophenyl)-2-butan-2-ylsulfanylethyl]propan-1-amine |
|---|---|
| PubChem CID | 106942561 |
| Molecular Formula | C15H22BrF2NS |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-[1-(3-bromo-2,6-difluorophenyl)-2-butan-2-ylsulfanylethyl]propan-1-amine |
| SMILES | CCCNC(CSC(C)CC)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H22BrF2NS/c1-4-8-19-13(9-20-10(3)5-2)14-12(17)7-6-11(16)15(14)18/h6-7,10,13,19H,4-5,8-9H2,1-3H3 |
| InChIKey | JSUIKELPIMBPRF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|