C15H22BrF2NO — CID 106943029
1-(3-bromo-2,6-difluorophenyl)-2-ethoxy-N-propylbutan-1-amine (PubChem CID 106943029) has the molecular formula C15H22BrF2NO and a molecular weight of 350.25 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2-ethoxy-N-propylbutan-1-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2-ethoxy-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 106943029 |
| Molecular Formula | C15H22BrF2NO |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2-ethoxy-N-propylbutan-1-amine |
| SMILES | CCCNC(c1c(F)ccc(Br)c1F)C(CC)OCC |
| InChI | InChI=1S/C15H22BrF2NO/c1-4-9-19-15(12(5-2)20-6-3)13-11(17)8-7-10(16)14(13)18/h7-8,12,15,19H,4-6,9H2,1-3H3 |
| InChIKey | NSWVCUIRTQXRPX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|