C15H22BrF2NO2 — CID 106942807
N-[1-(3-bromo-2,6-difluorophenyl)-2,2-diethoxyethyl]propan-1-amine (PubChem CID 106942807) has the molecular formula C15H22BrF2NO2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-[1-(3-bromo-2,6-difluorophenyl)-2,2-diethoxyethyl]propan-1-amine.
| Compound Name | N-[1-(3-bromo-2,6-difluorophenyl)-2,2-diethoxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 106942807 |
| Molecular Formula | C15H22BrF2NO2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-[1-(3-bromo-2,6-difluorophenyl)-2,2-diethoxyethyl]propan-1-amine |
| SMILES | CCCNC(c1c(F)ccc(Br)c1F)C(OCC)OCC |
| InChI | InChI=1S/C15H22BrF2NO2/c1-4-9-19-14(15(20-5-2)21-6-3)12-11(17)8-7-10(16)13(12)18/h7-8,14-15,19H,4-6,9H2,1-3H3 |
| InChIKey | CLGPYPUMESSSFT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|