C14H20BrClFNO2 — CID 106762753
1-(4-bromo-3-chloro-2-fluorophenyl)-2,2-diethoxy-N-ethylethanamine (PubChem CID 106762753) has the molecular formula C14H20BrClFNO2 and a molecular weight of 368.67 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-2,2-diethoxy-N-ethylethanamine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2,2-diethoxy-N-ethylethanamine |
|---|---|
| PubChem CID | 106762753 |
| Molecular Formula | C14H20BrClFNO2 |
| Molecular Weight | 368.67 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2,2-diethoxy-N-ethylethanamine |
| SMILES | CCNC(c1ccc(Br)c(Cl)c1F)C(OCC)OCC |
| InChI | InChI=1S/C14H20BrClFNO2/c1-4-18-13(14(19-5-2)20-6-3)9-7-8-10(15)11(16)12(9)17/h7-8,13-14,18H,4-6H2,1-3H3 |
| InChIKey | KXGHBKHVBVRPPY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|