C14H20BrClFN — CID 106764707
1-(4-bromo-3-chloro-2-fluorophenyl)-N-ethyl-2,2-dimethylbutan-1-amine (PubChem CID 106764707) has the molecular formula C14H20BrClFN and a molecular weight of 336.68 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-N-ethyl-2,2-dimethylbutan-1-amine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-N-ethyl-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 106764707 |
| Molecular Formula | C14H20BrClFN |
| Molecular Weight | 336.68 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-N-ethyl-2,2-dimethylbutan-1-amine |
| SMILES | CCNC(c1ccc(Br)c(Cl)c1F)C(C)(C)CC |
| InChI | InChI=1S/C14H20BrClFN/c1-5-14(3,4)13(18-6-2)9-7-8-10(15)11(16)12(9)17/h7-8,13,18H,5-6H2,1-4H3 |
| InChIKey | XOUGQGWPZKFEJY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|